C11H18N4OS — CID 79634834
1-amino-3-(1-methylpyrazol-4-yl)sulfanylcyclohexane-1-carboxamide (PubChem CID 79634834) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-amino-3-(1-methylpyrazol-4-yl)sulfanylcyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-(1-methylpyrazol-4-yl)sulfanylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79634834 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-amino-3-(1-methylpyrazol-4-yl)sulfanylcyclohexane-1-carboxamide |
| SMILES | Cn1cc(SC2CCCC(N)(C(N)=O)C2)cn1 |
| InChI | InChI=1S/C11H18N4OS/c1-15-7-9(6-14-15)17-8-3-2-4-11(13,5-8)10(12)16/h6-8H,2-5,13H2,1H3,(H2,12,16) |
| InChIKey | MPVDYFDRKJLFLN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |