C13H16Cl2N2OS — CID 79635792
1-amino-3-(3,4-dichlorophenyl)sulfanylcyclohexane-1-carboxamide (PubChem CID 79635792) has the molecular formula C13H16Cl2N2OS and a molecular weight of 319.26 g/mol. Its IUPAC name is 1-amino-3-(3,4-dichlorophenyl)sulfanylcyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-(3,4-dichlorophenyl)sulfanylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79635792 |
| Molecular Formula | C13H16Cl2N2OS |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-amino-3-(3,4-dichlorophenyl)sulfanylcyclohexane-1-carboxamide |
| SMILES | NC(=O)C1(N)CCCC(Sc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H16Cl2N2OS/c14-10-4-3-8(6-11(10)15)19-9-2-1-5-13(17,7-9)12(16)18/h3-4,6,9H,1-2,5,7,17H2,(H2,16,18) |
| InChIKey | HRRULTBPGMBNDY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |