C11H18N6OS — CID 79634807
1-amino-3-(1-cyclopropyltetrazol-5-yl)sulfanylcyclohexane-1-carboxamide (PubChem CID 79634807) has the molecular formula C11H18N6OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 1-amino-3-(1-cyclopropyltetrazol-5-yl)sulfanylcyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-(1-cyclopropyltetrazol-5-yl)sulfanylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79634807 |
| Molecular Formula | C11H18N6OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-amino-3-(1-cyclopropyltetrazol-5-yl)sulfanylcyclohexane-1-carboxamide |
| SMILES | NC(=O)C1(N)CCCC(Sc2nnnn2C2CC2)C1 |
| InChI | InChI=1S/C11H18N6OS/c12-9(18)11(13)5-1-2-8(6-11)19-10-14-15-16-17(10)7-3-4-7/h7-8H,1-6,13H2,(H2,12,18) |
| InChIKey | SURYUALMFLOOKV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |