C13H18N2OS — CID 79653394
1-amino-3-(3-methylphenyl)sulfanylcyclopentane-1-carboxamide (PubChem CID 79653394) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-amino-3-(3-methylphenyl)sulfanylcyclopentane-1-carboxamide.
| Compound Name | 1-amino-3-(3-methylphenyl)sulfanylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79653394 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-amino-3-(3-methylphenyl)sulfanylcyclopentane-1-carboxamide |
| SMILES | Cc1cccc(SC2CCC(N)(C(N)=O)C2)c1 |
| InChI | InChI=1S/C13H18N2OS/c1-9-3-2-4-10(7-9)17-11-5-6-13(15,8-11)12(14)16/h2-4,7,11H,5-6,8,15H2,1H3,(H2,14,16) |
| InChIKey | CZCBHNAJNVLHGK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |