C15H27NO2S — CID 79653723
ethyl 1-amino-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxylate (PubChem CID 79653723) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is ethyl 1-amino-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxylate.
| Compound Name | ethyl 1-amino-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79653723 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | ethyl 1-amino-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(N)CCC(SC2CCCC(C)C2)C1 |
| InChI | InChI=1S/C15H27NO2S/c1-3-18-14(17)15(16)8-7-13(10-15)19-12-6-4-5-11(2)9-12/h11-13H,3-10,16H2,1-2H3 |
| InChIKey | UZIKXOXKIOYMLW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |