C14H27NOS — CID 79640996
[1-amino-3-(3-methylcyclohexyl)sulfanylcyclohexyl]methanol (PubChem CID 79640996) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is [1-amino-3-(3-methylcyclohexyl)sulfanylcyclohexyl]methanol.
| Compound Name | [1-amino-3-(3-methylcyclohexyl)sulfanylcyclohexyl]methanol |
|---|---|
| PubChem CID | 79640996 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | [1-amino-3-(3-methylcyclohexyl)sulfanylcyclohexyl]methanol |
| SMILES | CC1CCCC(SC2CCCC(N)(CO)C2)C1 |
| InChI | InChI=1S/C14H27NOS/c1-11-4-2-5-12(8-11)17-13-6-3-7-14(15,9-13)10-16/h11-13,16H,2-10,15H2,1H3 |
| InChIKey | VOFOLRDCKJFANN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |