About [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol
[1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol (PubChem CID 79640365) has the molecular formula C10H17N3OS2
and a molecular weight of 259.40 g/mol. Its IUPAC name is [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol |
| PubChem CID | 79640365 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol |
| SMILES | Cc1nnc(SC2CCCC(N)(CO)C2)s1 |
| InChI | InChI=1S/C10H17N3OS2/c1-7-12-13-9(15-7)16-8-3-2-4-10(11,5-8)6-14/h8,14H,2-6,11H2,1H3 |
| InChIKey | KNZXNROVRHYKCJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol?
The IUPAC name of [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol (CID 79640365) is [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol.
What is the SMILES notation for [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol?
The canonical SMILES for [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol is Cc1nnc(SC2CCCC(N)(CO)C2)s1.
What is the InChIKey of [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol?
The InChIKey is KNZXNROVRHYKCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS2/c1-7-12-13-9(15-7)16-8-3-2-4-10(11,5-8)6-14/h8,14H,2-6,11H2,1H3.
What are the key properties of [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol?
[1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol has a molecular weight of 259.40 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexyl]methanol is sourced from PubChem (CID 79640365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).