C14H21NO3S2 — CID 79640280
[1-amino-3-(4-methylsulfonylphenyl)sulfanylcyclohexyl]methanol (PubChem CID 79640280) has the molecular formula C14H21NO3S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is [1-amino-3-(4-methylsulfonylphenyl)sulfanylcyclohexyl]methanol.
| Compound Name | [1-amino-3-(4-methylsulfonylphenyl)sulfanylcyclohexyl]methanol |
|---|---|
| PubChem CID | 79640280 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [1-amino-3-(4-methylsulfonylphenyl)sulfanylcyclohexyl]methanol |
| SMILES | CS(=O)(=O)c1ccc(SC2CCCC(N)(CO)C2)cc1 |
| InChI | InChI=1S/C14H21NO3S2/c1-20(17,18)13-6-4-11(5-7-13)19-12-3-2-8-14(15,9-12)10-16/h4-7,12,16H,2-3,8-10,15H2,1H3 |
| InChIKey | OSOVATOOAQZTMA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |