C13H22O2S — CID 115000251
1-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxylic acid (PubChem CID 115000251) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is 1-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxylic acid.
| Compound Name | 1-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 115000251 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxylic acid |
| SMILES | CC1CCCC(SC2(C(=O)O)CCCC2)C1 |
| InChI | InChI=1S/C13H22O2S/c1-10-5-4-6-11(9-10)16-13(12(14)15)7-2-3-8-13/h10-11H,2-9H2,1H3,(H,14,15) |
| InChIKey | IKEYEQYNKWRASH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |