C11H17F3O2S — CID 63100018
4,4,4-trifluoro-3-(3-methylcyclohexyl)sulfanylbutanoic acid (PubChem CID 63100018) has the molecular formula C11H17F3O2S and a molecular weight of 270.32 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(3-methylcyclohexyl)sulfanylbutanoic acid.
| Compound Name | 4,4,4-trifluoro-3-(3-methylcyclohexyl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 63100018 |
| Molecular Formula | C11H17F3O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4,4,4-trifluoro-3-(3-methylcyclohexyl)sulfanylbutanoic acid |
| SMILES | CC1CCCC(SC(CC(=O)O)C(F)(F)F)C1 |
| InChI | InChI=1S/C11H17F3O2S/c1-7-3-2-4-8(5-7)17-9(6-10(15)16)11(12,13)14/h7-9H,2-6H2,1H3,(H,15,16) |
| InChIKey | OGHAVWALRRHZGU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |