C10H19NOS — CID 62721555
3-(3-methylcyclohexyl)sulfanylpropanamide (PubChem CID 62721555) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 3-(3-methylcyclohexyl)sulfanylpropanamide.
| Compound Name | 3-(3-methylcyclohexyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 62721555 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-(3-methylcyclohexyl)sulfanylpropanamide |
| SMILES | CC1CCCC(SCCC(N)=O)C1 |
| InChI | InChI=1S/C10H19NOS/c1-8-3-2-4-9(7-8)13-6-5-10(11)12/h8-9H,2-7H2,1H3,(H2,11,12) |
| InChIKey | KGDZQASVQDANGX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |