C15H30N2OS — CID 62720840
2-methyl-2-(methylamino)-6-(3-methylcyclohexyl)sulfanylhexanamide (PubChem CID 62720840) has the molecular formula C15H30N2OS and a molecular weight of 286.48 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-6-(3-methylcyclohexyl)sulfanylhexanamide.
| Compound Name | 2-methyl-2-(methylamino)-6-(3-methylcyclohexyl)sulfanylhexanamide |
|---|---|
| PubChem CID | 62720840 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 2-methyl-2-(methylamino)-6-(3-methylcyclohexyl)sulfanylhexanamide |
| SMILES | CNC(C)(CCCCSC1CCCC(C)C1)C(N)=O |
| InChI | InChI=1S/C15H30N2OS/c1-12-7-6-8-13(11-12)19-10-5-4-9-15(2,17-3)14(16)18/h12-13,17H,4-11H2,1-3H3,(H2,16,18) |
| InChIKey | AJCBOWOOVBPFQR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|