C14H27NOS — CID 79645546
[1-(methylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentyl]methanol (PubChem CID 79645546) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is [1-(methylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentyl]methanol.
| Compound Name | [1-(methylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentyl]methanol |
|---|---|
| PubChem CID | 79645546 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | [1-(methylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentyl]methanol |
| SMILES | CNC1(CO)CCC(SC2CCCC(C)C2)C1 |
| InChI | InChI=1S/C14H27NOS/c1-11-4-3-5-12(8-11)17-13-6-7-14(9-13,10-16)15-2/h11-13,15-16H,3-10H2,1-2H3 |
| InChIKey | UHKLCNWSQXWNKQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |