C17H26FNOS — CID 79587185
[2-[2-(4-fluorophenyl)sulfanylethyl]-1-(propan-2-ylamino)cyclopentyl]methanol (PubChem CID 79587185) has the molecular formula C17H26FNOS and a molecular weight of 311.47 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)sulfanylethyl]-1-(propan-2-ylamino)cyclopentyl]methanol.
| Compound Name | [2-[2-(4-fluorophenyl)sulfanylethyl]-1-(propan-2-ylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 79587185 |
| Molecular Formula | C17H26FNOS |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | [2-[2-(4-fluorophenyl)sulfanylethyl]-1-(propan-2-ylamino)cyclopentyl]methanol |
| SMILES | CC(C)NC1(CO)CCCC1CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C17H26FNOS/c1-13(2)19-17(12-20)10-3-4-14(17)9-11-21-16-7-5-15(18)6-8-16/h5-8,13-14,19-20H,3-4,9-12H2,1-2H3 |
| InChIKey | CPEIWPLLMHGAPY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |