C15H22FNOS — CID 64805531
2-(cyclopropylamino)-5-(2-fluorophenyl)sulfanyl-2-methylpentan-1-ol (PubChem CID 64805531) has the molecular formula C15H22FNOS and a molecular weight of 283.41 g/mol. Its IUPAC name is 2-(cyclopropylamino)-5-(2-fluorophenyl)sulfanyl-2-methylpentan-1-ol.
| Compound Name | 2-(cyclopropylamino)-5-(2-fluorophenyl)sulfanyl-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 64805531 |
| Molecular Formula | C15H22FNOS |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(cyclopropylamino)-5-(2-fluorophenyl)sulfanyl-2-methylpentan-1-ol |
| SMILES | CC(CO)(CCCSc1ccccc1F)NC1CC1 |
| InChI | InChI=1S/C15H22FNOS/c1-15(11-18,17-12-7-8-12)9-4-10-19-14-6-3-2-5-13(14)16/h2-3,5-6,12,17-18H,4,7-11H2,1H3 |
| InChIKey | VFUBKAIRRINZLH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|