C14H22FNOS — CID 155010649
(1S)-2-[(4-fluorophenyl)-dimethyl-λ4-sulfanyl]-1-[(2S)-pyrrolidin-2-yl]ethanol (PubChem CID 155010649) has the molecular formula C14H22FNOS and a molecular weight of 271.40 g/mol. Its IUPAC name is (1S)-2-[(4-fluorophenyl)-dimethyl-λ4-sulfanyl]-1-[(2S)-pyrrolidin-2-yl]ethanol.
| Compound Name | (1S)-2-[(4-fluorophenyl)-dimethyl-λ4-sulfanyl]-1-[(2S)-pyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 155010649 |
| Molecular Formula | C14H22FNOS |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (1S)-2-[(4-fluorophenyl)-dimethyl-λ4-sulfanyl]-1-[(2S)-pyrrolidin-2-yl]ethanol |
| SMILES | CS(C)(C[C@@H](O)[C@@H]1CCCN1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H22FNOS/c1-18(2,12-7-5-11(15)6-8-12)10-14(17)13-4-3-9-16-13/h5-8,13-14,16-17H,3-4,9-10H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | NRDCRBIHGQRMKW-UONOGXRCSA-N |
| XLogP | 2.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |