C13H17NO2S — CID 134851661
(2S,3S,4R,5R)-2-ethenyl-5-(phenylsulfanylmethyl)pyrrolidine-3,4-diol (PubChem CID 134851661) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-ethenyl-5-(phenylsulfanylmethyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-ethenyl-5-(phenylsulfanylmethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 134851661 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (2S,3S,4R,5R)-2-ethenyl-5-(phenylsulfanylmethyl)pyrrolidine-3,4-diol |
| SMILES | C=C[C@@H]1N[C@@H](CSc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17NO2S/c1-2-10-12(15)13(16)11(14-10)8-17-9-6-4-3-5-7-9/h2-7,10-16H,1,8H2/t10-,11-,12-,13+/m0/s1 |
| InChIKey | MYLOUXYKLBPCJH-ZDEQEGDKSA-N |
| XLogP | 1.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|