C17H26ClNOS — CID 79587180
[2-[2-(2-chlorophenyl)sulfanylethyl]-1-(propan-2-ylamino)cyclopentyl]methanol (PubChem CID 79587180) has the molecular formula C17H26ClNOS and a molecular weight of 327.92 g/mol. Its IUPAC name is [2-[2-(2-chlorophenyl)sulfanylethyl]-1-(propan-2-ylamino)cyclopentyl]methanol.
| Compound Name | [2-[2-(2-chlorophenyl)sulfanylethyl]-1-(propan-2-ylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 79587180 |
| Molecular Formula | C17H26ClNOS |
| Molecular Weight | 327.92 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [2-[2-(2-chlorophenyl)sulfanylethyl]-1-(propan-2-ylamino)cyclopentyl]methanol |
| SMILES | CC(C)NC1(CO)CCCC1CCSc1ccccc1Cl |
| InChI | InChI=1S/C17H26ClNOS/c1-13(2)19-17(12-20)10-5-6-14(17)9-11-21-16-8-4-3-7-15(16)18/h3-4,7-8,13-14,19-20H,5-6,9-12H2,1-2H3 |
| InChIKey | NMYDPEJRQSXXCO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.92 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |