C16H23NO2 — CID 67920649
methyl 1-amino-2-(2-phenylethyl)cyclohexane-1-carboxylate (PubChem CID 67920649) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is methyl 1-amino-2-(2-phenylethyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 1-amino-2-(2-phenylethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67920649 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | methyl 1-amino-2-(2-phenylethyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCCCC1CCc1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-19-15(18)16(17)12-6-5-9-14(16)11-10-13-7-3-2-4-8-13/h2-4,7-8,14H,5-6,9-12,17H2,1H3 |
| InChIKey | ZUYADLBMHWBJQQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |