C15H21NO3 — CID 82762798
(3-methoxyphenyl)methyl 2-amino-1-methylcyclopentane-1-carboxylate (PubChem CID 82762798) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-amino-1-methylcyclopentane-1-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 2-amino-1-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 82762798 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-amino-1-methylcyclopentane-1-carboxylate |
| SMILES | COc1cccc(COC(=O)C2(C)CCCC2N)c1 |
| InChI | InChI=1S/C15H21NO3/c1-15(8-4-7-13(15)16)14(17)19-10-11-5-3-6-12(9-11)18-2/h3,5-6,9,13H,4,7-8,10,16H2,1-2H3 |
| InChIKey | ZMWBTUNABIRZJN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |