C15H23NO2 — CID 62110928
2-[(3-methoxyphenyl)methoxy]cycloheptan-1-amine (PubChem CID 62110928) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methoxy]cycloheptan-1-amine.
| Compound Name | 2-[(3-methoxyphenyl)methoxy]cycloheptan-1-amine |
|---|---|
| PubChem CID | 62110928 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-[(3-methoxyphenyl)methoxy]cycloheptan-1-amine |
| SMILES | COc1cccc(COC2CCCCCC2N)c1 |
| InChI | InChI=1S/C15H23NO2/c1-17-13-7-5-6-12(10-13)11-18-15-9-4-2-3-8-14(15)16/h5-7,10,14-15H,2-4,8-9,11,16H2,1H3 |
| InChIKey | KBNCGOZOSUMKLR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |