C12H16ClNO — CID 126644466
trans-(1S,2S)-2-[(3-chlorophenyl)methoxy]cyclopentan-1-amine (PubChem CID 126644466) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(3-chlorophenyl)methoxy]cyclopentan-1-amine.
| Compound Name | trans-(1S,2S)-2-[(3-chlorophenyl)methoxy]cyclopentan-1-amine |
|---|---|
| PubChem CID | 126644466 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | trans-(1S,2S)-2-[(3-chlorophenyl)methoxy]cyclopentan-1-amine |
| SMILES | N[C@H]1CCC[C@@H]1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO/c13-10-4-1-3-9(7-10)8-15-12-6-2-5-11(12)14/h1,3-4,7,11-12H,2,5-6,8,14H2/t11-,12-/m0/s1 |
| InChIKey | UVSACZBEUQGYAU-RYUDHWBXSA-N |
| XLogP | 2.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |