C23H44 — CID 123992399
5-(3,7-dimethylnonyl)-1,2,3,4,4,6-hexamethylcyclohexene (PubChem CID 123992399) has the molecular formula C23H44 and a molecular weight of 320.61 g/mol. Its IUPAC name is 5-(3,7-dimethylnonyl)-1,2,3,4,4,6-hexamethylcyclohexene.
| Compound Name | 5-(3,7-dimethylnonyl)-1,2,3,4,4,6-hexamethylcyclohexene |
|---|---|
| PubChem CID | 123992399 |
| Molecular Formula | C23H44 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 320.34 |
| IUPAC Name | 5-(3,7-dimethylnonyl)-1,2,3,4,4,6-hexamethylcyclohexene |
| SMILES | CCC(C)CCCC(C)CCC1C(C)C(C)=C(C)C(C)C1(C)C |
| InChI | InChI=1S/C23H44/c1-10-16(2)12-11-13-17(3)14-15-22-20(6)18(4)19(5)21(7)23(22,8)9/h16-17,20-22H,10-15H2,1-9H3 |
| InChIKey | QYSCNWGJXQRBOL-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|