C39H58O — CID 122390296
bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,9,10,10a-octahydrophenanthren-1-yl)methanone (PubChem CID 122390296) has the molecular formula C39H58O and a molecular weight of 542.89 g/mol. Its IUPAC name is bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,9,10,10a-octahydrophenanthren-1-yl)methanone.
| Compound Name | bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,9,10,10a-octahydrophenanthren-1-yl)methanone |
|---|---|
| PubChem CID | 122390296 |
| Molecular Formula | C39H58O |
| Molecular Weight | 542.89 g/mol |
| Exact Mass | 542.45 |
| IUPAC Name | bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,9,10,10a-octahydrophenanthren-1-yl)methanone |
| SMILES | CC(C)C1=CCC2C(=C1)CCC1C(C)(C(=O)C3(C)CCCC4(C)C5CC=C(C(C)C)C=C5CCC34)CCCC21C |
| InChI | InChI=1S/C39H58O/c1-25(2)27-11-15-31-29(23-27)13-17-33-36(31,5)19-9-21-38(33,7)35(40)39(8)22-10-20-37(6)32-16-12-28(26(3)4)24-30(32)14-18-34(37)39/h11-12,23-26,31-34H,9-10,13-22H2,1-8H3 |
| InChIKey | MDFKLQZQARCNGM-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.89 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |