C44H66O5 — CID 118232736
bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,9,10,10a-octahydrophenanthren-1-yl) 3-hydroxyhexanedioate (PubChem CID 118232736) has the molecular formula C44H66O5 and a molecular weight of 675.01 g/mol. Its IUPAC name is bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,9,10,10a-octahydrophenanthren-1-yl) 3-hydroxyhexanedioate.
| Compound Name | bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,9,10,10a-octahydrophenanthren-1-yl) 3-hydroxyhexanedioate |
|---|---|
| PubChem CID | 118232736 |
| Molecular Formula | C44H66O5 |
| Molecular Weight | 675.01 g/mol |
| Exact Mass | 674.49 |
| IUPAC Name | bis(1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,9,10,10a-octahydrophenanthren-1-yl) 3-hydroxyhexanedioate |
| SMILES | CC(C)C1=CCC2C(=C1)CCC1C(C)(OC(=O)CCC(O)CC(=O)OC3(C)CCCC4(C)C5CC=C(C(C)C)C=C5CCC34)CCCC21C |
| InChI | InChI=1S/C44H66O5/c1-28(2)30-11-16-35-32(25-30)13-18-37-41(35,5)21-9-23-43(37,7)48-39(46)20-15-34(45)27-40(47)49-44(8)24-10-22-42(6)36-17-12-31(29(3)4)26-33(36)14-19-38(42)44/h11-12,25-26,28-29,34-38,45H,9-10,13-24,27H2,1-8H3 |
| InChIKey | YZUZOFWFRLJRLK-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.01 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |