C21H32O4 — CID 18649185
methyl (1S,4aR,4bS)-1-(dihydroxymethyl)-4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate (PubChem CID 18649185) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (1S,4aR,4bS)-1-(dihydroxymethyl)-4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aR,4bS)-1-(dihydroxymethyl)-4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 18649185 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (1S,4aR,4bS)-1-(dihydroxymethyl)-4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C(O)O)CCC[C@@]2(C)C1CC=C1C=C(C(C)C)CC[C@H]12 |
| InChI | InChI=1S/C21H32O4/c1-13(2)14-6-8-16-15(12-14)7-9-17-20(16,3)10-5-11-21(17,18(22)23)19(24)25-4/h7,12-13,16-18,22-23H,5-6,8-11H2,1-4H3/t16-,17?,20-,21+/m1/s1 |
| InChIKey | DWDMOIVQLFCSBJ-IZBPLUDHSA-N |
| XLogP | 3.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|