C32H56O2Sn — CID 16683742
tris(2-methylpropyl)stannyl 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate (PubChem CID 16683742) has the molecular formula C32H56O2Sn and a molecular weight of 591.51 g/mol. Its IUPAC name is tris(2-methylpropyl)stannyl 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate.
| Compound Name | tris(2-methylpropyl)stannyl 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 16683742 |
| Molecular Formula | C32H56O2Sn |
| Molecular Weight | 591.51 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | tris(2-methylpropyl)stannyl 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
| SMILES | CC(C)C[Sn](CC(C)C)(CC(C)C)OC(=O)C1(C)CCCC2(C)C3CCC(C(C)C)=CC3=CCC12 |
| InChI | InChI=1S/C20H30O2.3C4H9.Sn/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22;3*1-4(2)3;/h7,12-13,16-17H,5-6,8-11H2,1-4H3,(H,21,22);3*4H,1H2,2-3H3;/q;;;;+1/p-1 |
| InChIKey | YNAFTIFPYUTQQI-UHFFFAOYSA-M |
| XLogP | 9.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.51 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |