C29H38O2 — CID 101240912
(4-ethenylphenyl)methyl (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate (PubChem CID 101240912) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate.
| Compound Name | (4-ethenylphenyl)methyl (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 101240912 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (4-ethenylphenyl)methyl (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
| SMILES | C=Cc1ccc(COC(=O)[C@]2(C)CCC[C@@]3(C)[C@H]2CC=C2C=C(C(C)C)CC[C@@H]23)cc1 |
| InChI | InChI=1S/C29H38O2/c1-6-21-8-10-22(11-9-21)19-31-27(30)29(5)17-7-16-28(4)25-14-12-23(20(2)3)18-24(25)13-15-26(28)29/h6,8-11,13,18,20,25-26H,1,7,12,14-17,19H2,2-5H3/t25-,26+,28+,29+/m0/s1 |
| InChIKey | NPJUISSMVAQOBO-WNOSTQBWSA-N |
| XLogP | 7.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |