C46H58O5P+ — CID 171348123
[5-[3-[(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl]oxy-2-hydroxypropoxy]-5-oxopentyl]-triphenylphosphanium (PubChem CID 171348123) has the molecular formula C46H58O5P+ and a molecular weight of 721.94 g/mol. Its IUPAC name is [5-[3-[(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl]oxy-2-hydroxypropoxy]-5-oxopentyl]-triphenylphosphanium.
| Compound Name | [5-[3-[(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl]oxy-2-hydroxypropoxy]-5-oxopentyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 171348123 |
| Molecular Formula | C46H58O5P+ |
| Molecular Weight | 721.94 g/mol |
| Exact Mass | 721.40 |
| IUPAC Name | [5-[3-[(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl]oxy-2-hydroxypropoxy]-5-oxopentyl]-triphenylphosphanium |
| SMILES | CC(C)C1=CC2=CC[C@@H]3[C@](C)(CCC[C@@]3(C)C(=O)OCC(O)COC(=O)CCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)[C@H]2CC1 |
| InChI | InChI=1S/C46H58O5P/c1-34(2)35-24-26-41-36(31-35)25-27-42-45(41,3)28-16-29-46(42,4)44(49)51-33-37(47)32-50-43(48)23-14-15-30-52(38-17-8-5-9-18-38,39-19-10-6-11-20-39)40-21-12-7-13-22-40/h5-13,17-22,25,31,34,37,41-42,47H,14-16,23-24,26-30,32-33H2,1-4H3/q+1/t37?,41-,42+,45+,46+/m0/s1 |
| InChIKey | STJXYAPWXWCHNK-JCGIHBKMSA-N |
| XLogP | 8.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.94 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|