C21H32O2 — CID 67303501
(1R,4aR,4bR)-1-ethyl-4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid (PubChem CID 67303501) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (1R,4aR,4bR)-1-ethyl-4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aR,4bR)-1-ethyl-4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 67303501 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (1R,4aR,4bR)-1-ethyl-4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid |
| SMILES | CC[C@@]1(C(=O)O)CCC[C@@]2(C)C1CC=C1C=C(C(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C21H32O2/c1-5-21(19(22)23)12-6-11-20(4)17-9-7-15(14(2)3)13-16(17)8-10-18(20)21/h8,13-14,17-18H,5-7,9-12H2,1-4H3,(H,22,23)/t17-,18?,20+,21+/m0/s1 |
| InChIKey | JBQLLCNLWYUSNM-MWBYQJBMSA-N |
| XLogP | 5.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |