C20H31I — CID 102381702
(1R,4aR,4bR,10aR)-1-(iodomethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene (PubChem CID 102381702) has the molecular formula C20H31I and a molecular weight of 398.37 g/mol. Its IUPAC name is (1R,4aR,4bR,10aR)-1-(iodomethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene.
| Compound Name | (1R,4aR,4bR,10aR)-1-(iodomethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 102381702 |
| Molecular Formula | C20H31I |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (1R,4aR,4bR,10aR)-1-(iodomethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene |
| SMILES | CC(C)C1=CC2=CC[C@H]3[C@](C)(CI)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C20H31I/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4/h7,12,14,17-18H,5-6,8-11,13H2,1-4H3/t17-,18-,19-,20+/m0/s1 |
| InChIKey | HNSLHZQEVZTJST-LWYYNNOASA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|