C24H41O4P — CID 118395382
[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl diethyl phosphate (PubChem CID 118395382) has the molecular formula C24H41O4P and a molecular weight of 424.56 g/mol. Its IUPAC name is [(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl diethyl phosphate.
| Compound Name | [(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl diethyl phosphate |
|---|---|
| PubChem CID | 118395382 |
| Molecular Formula | C24H41O4P |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | [(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC[C@@]1(C)CCC[C@@]2(C)C1CC=C1C=C(C(C)C)CC[C@H]12 |
| InChI | InChI=1S/C24H41O4P/c1-7-26-29(25,27-8-2)28-17-23(5)14-9-15-24(6)21-12-10-19(18(3)4)16-20(21)11-13-22(23)24/h11,16,18,21-22H,7-10,12-15,17H2,1-6H3/t21-,22?,23-,24-/m1/s1 |
| InChIKey | YLAZWLJIZNMKOO-ATDZWHFBSA-N |
| XLogP | 7.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|