C25H39NO4 — CID 44592777
ethyl 2-[[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl]amino]-3-hydroxypropanoate (PubChem CID 44592777) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is ethyl 2-[[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl]amino]-3-hydroxypropanoate.
| Compound Name | ethyl 2-[[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 44592777 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | ethyl 2-[[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl]amino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(CO)NC(=O)[C@@]1(C)CCC[C@@]2(C)C1CC=C1C=C(C(C)C)CC[C@H]12 |
| InChI | InChI=1S/C25H39NO4/c1-6-30-22(28)20(15-27)26-23(29)25(5)13-7-12-24(4)19-10-8-17(16(2)3)14-18(19)9-11-21(24)25/h9,14,16,19-21,27H,6-8,10-13,15H2,1-5H3,(H,26,29)/t19-,20?,21?,24-,25+/m1/s1 |
| InChIKey | MVIDEWQCLWCLHW-CZZLWMTQSA-N |
| XLogP | 4.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |