C23H33NO5 — CID 134827956
(2S)-3-hydroxy-2-[[2-methyl-5-[(1R,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoyl]amino]propanoic acid (PubChem CID 134827956) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[[2-methyl-5-[(1R,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[[2-methyl-5-[(1R,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134827956 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (2S)-3-hydroxy-2-[[2-methyl-5-[(1R,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoyl]amino]propanoic acid |
| SMILES | C=C1C[C@]23C=CC(=O)[C@@](C)(CCCC(C)C(=O)N[C@@H](CO)C(=O)O)[C@@H]2C[C@@H]1CC3 |
| InChI | InChI=1S/C23H33NO5/c1-14(20(27)24-17(13-25)21(28)29)5-4-8-22(3)18-11-16-6-9-23(18,12-15(16)2)10-7-19(22)26/h7,10,14,16-18,25H,2,4-6,8-9,11-13H2,1,3H3,(H,24,27)(H,28,29)/t14?,16-,17-,18-,22-,23-/m0/s1 |
| InChIKey | YAYCUOBLGVILOH-SEFQCBLZSA-N |
| XLogP | 2.86 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|