C35H55NO4 — CID 45482026
(2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 45482026) has the molecular formula C35H55NO4 and a molecular weight of 553.83 g/mol. Its IUPAC name is (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 45482026 |
| Molecular Formula | C35H55NO4 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 553.41 |
| IUPAC Name | (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@]12CCC(C)(C)C[C@@H]1C1=CC[C@@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2)C(=O)O |
| InChI | InChI=1S/C35H55NO4/c1-21(2)27(28(38)39)36-29(40)35-18-16-30(3,4)20-23(35)22-10-11-25-32(7)14-13-26(37)31(5,6)24(32)12-15-34(25,9)33(22,8)17-19-35/h10,21,23-25,27H,11-20H2,1-9H3,(H,36,40)(H,38,39)/t23-,24+,25-,27+,32+,33-,34-,35+/m1/s1 |
| InChIKey | IFELXALKXPQZMA-LIXLHYMBSA-N |
| XLogP | 7.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|