C31H48O4 — CID 10576857
methyl (4aS,6aR,6aR,6bR,12aR)-6a-(hydroxymethyl)-2,2,6b,9,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate (PubChem CID 10576857) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is methyl (4aS,6aR,6aR,6bR,12aR)-6a-(hydroxymethyl)-2,2,6b,9,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6aR,6bR,12aR)-6a-(hydroxymethyl)-2,2,6b,9,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 10576857 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | methyl (4aS,6aR,6aR,6bR,12aR)-6a-(hydroxymethyl)-2,2,6b,9,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1=CC[C@@H]3[C@@]4(C)CCC(=O)C(C)(C)C4CC[C@@]3(C)[C@]1(CO)CC2 |
| InChI | InChI=1S/C31H48O4/c1-26(2)14-15-30(25(34)35-7)16-17-31(19-32)20(21(30)18-26)8-9-23-28(5)12-11-24(33)27(3,4)22(28)10-13-29(23,31)6/h8,21-23,32H,9-19H2,1-7H3/t21?,22?,23-,28+,29-,30+,31+/m1/s1 |
| InChIKey | WFSRYBDBVVKPNL-HLBWPDQRSA-N |
| XLogP | 6.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|