C30H46O3 — CID 123614291
methyl 1,6a,6b,9,9,12a-hexamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 123614291) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is methyl 1,6a,6b,9,9,12a-hexamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | methyl 1,6a,6b,9,9,12a-hexamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 123614291 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | methyl 1,6a,6b,9,9,12a-hexamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | COC(=O)C12CCCC(C)C1C1=CCC3C4(C)CCC(=O)C(C)(C)C4CCC3(C)C1(C)CC2 |
| InChI | InChI=1S/C30H46O3/c1-19-9-8-14-30(25(32)33-7)18-17-28(5)20(24(19)30)10-11-22-27(4)15-13-23(31)26(2,3)21(27)12-16-29(22,28)6/h10,19,21-22,24H,8-9,11-18H2,1-7H3 |
| InChIKey | WITYVOJKXVSUBE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|