C35H57NO3 — CID 171454251
tert-butyl N-[[(1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicen-4a-yl]methyl]carbamate (PubChem CID 171454251) has the molecular formula C35H57NO3 and a molecular weight of 539.85 g/mol. Its IUPAC name is tert-butyl N-[[(1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicen-4a-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicen-4a-yl]methyl]carbamate |
|---|---|
| PubChem CID | 171454251 |
| Molecular Formula | C35H57NO3 |
| Molecular Weight | 539.85 g/mol |
| Exact Mass | 539.43 |
| IUPAC Name | tert-butyl N-[[(1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicen-4a-yl]methyl]carbamate |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(CNC(=O)OC(C)(C)C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C35H57NO3/c1-22-13-18-35(21-36-29(38)39-30(3,4)5)20-19-33(9)24(28(35)23(22)2)11-12-26-32(8)16-15-27(37)31(6,7)25(32)14-17-34(26,33)10/h11,22-23,25-26,28H,12-21H2,1-10H3,(H,36,38)/t22-,23+,25+,26-,28+,32+,33-,34-,35-/m1/s1 |
| InChIKey | ZFQRFJKJZYJHAE-OQPRZYPMSA-N |
| XLogP | 8.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.85 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|