C42H58O5 — CID 54416904
(6bR,12aR)-6a-[2-[(E)-3-(3,4-dimethylphenyl)prop-2-enoyl]oxyethyl]-2,2,6b,9,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid (PubChem CID 54416904) has the molecular formula C42H58O5 and a molecular weight of 642.92 g/mol. Its IUPAC name is (6bR,12aR)-6a-[2-[(E)-3-(3,4-dimethylphenyl)prop-2-enoyl]oxyethyl]-2,2,6b,9,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | (6bR,12aR)-6a-[2-[(E)-3-(3,4-dimethylphenyl)prop-2-enoyl]oxyethyl]-2,2,6b,9,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 54416904 |
| Molecular Formula | C42H58O5 |
| Molecular Weight | 642.92 g/mol |
| Exact Mass | 642.43 |
| IUPAC Name | (6bR,12aR)-6a-[2-[(E)-3-(3,4-dimethylphenyl)prop-2-enoyl]oxyethyl]-2,2,6b,9,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid |
| SMILES | Cc1ccc(/C=C/C(=O)OCCC23CCC4(C(=O)O)CCC(C)(C)CC4C2=CCC2[C@@]4(C)CCC(=O)C(C)(C)C4CC[C@]23C)cc1C |
| InChI | InChI=1S/C42H58O5/c1-27-9-10-29(25-28(27)2)11-14-35(44)47-24-23-42-22-21-41(36(45)46)20-19-37(3,4)26-31(41)30(42)12-13-33-39(7)17-16-34(43)38(5,6)32(39)15-18-40(33,42)8/h9-12,14,25,31-33H,13,15-24,26H2,1-8H3,(H,45,46)/b14-11+/t31?,32?,33?,39-,40+,41?,42?/m0/s1 |
| InChIKey | VYCBAVPJPWYORJ-TZJLYPJISA-N |
| XLogP | 9.69 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.92 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|