C30H48O3 — CID 10789992
(4aS,6aR,6aR,6bR,12aS)-6a-(hydroxymethyl)-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 10789992) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is (4aS,6aR,6aR,6bR,12aS)-6a-(hydroxymethyl)-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | (4aS,6aR,6aR,6bR,12aS)-6a-(hydroxymethyl)-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 10789992 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (4aS,6aR,6aR,6bR,12aS)-6a-(hydroxymethyl)-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(CO)C(=CC[C@@H]4[C@@]5(C)CCCC(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C30H48O3/c1-25(2)14-15-29(24(32)33)16-17-30(19-31)20(21(29)18-25)8-9-23-27(5)12-7-11-26(3,4)22(27)10-13-28(23,30)6/h8,21-23,31H,7,9-19H2,1-6H3,(H,32,33)/t21?,22?,23-,27+,28-,29+,30+/m1/s1 |
| InChIKey | KHHWCBRVDQLTHB-RSJNVUIYSA-N |
| XLogP | 7.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|