C24H32N2O2 — CID 23883952
pyrimidin-2-yl 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate (PubChem CID 23883952) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is pyrimidin-2-yl 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate.
| Compound Name | pyrimidin-2-yl 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 23883952 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | pyrimidin-2-yl 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
| SMILES | CC(C)C1=CC2=CCC3C(C)(C(=O)Oc4ncccn4)CCCC3(C)C2CC1 |
| InChI | InChI=1S/C24H32N2O2/c1-16(2)17-7-9-19-18(15-17)8-10-20-23(19,3)11-5-12-24(20,4)21(27)28-22-25-13-6-14-26-22/h6,8,13-16,19-20H,5,7,9-12H2,1-4H3 |
| InChIKey | JXAJPSGJMKCWBV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |