C17H28O — CID 10966872
(2S,4aR,4bS,8aS)-4b,8,8-trimethyl-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ol (PubChem CID 10966872) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (2S,4aR,4bS,8aS)-4b,8,8-trimethyl-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ol.
| Compound Name | (2S,4aR,4bS,8aS)-4b,8,8-trimethyl-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 10966872 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (2S,4aR,4bS,8aS)-4b,8,8-trimethyl-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]3CC[C@H](O)C=C3CC[C@@H]12 |
| InChI | InChI=1S/C17H28O/c1-16(2)9-4-10-17(3)14-7-6-13(18)11-12(14)5-8-15(16)17/h11,13-15,18H,4-10H2,1-3H3/t13-,14+,15-,17+/m0/s1 |
| InChIKey | SOOZMGAVQMDPKJ-QSJFSLAZSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|