C19H29O7P2-3 — CID 140851064
[[(2Z)-2-[(4aR,4bR,8aR)-4b,8,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-ylidene]ethoxy]-oxidophosphoryl] phosphate (PubChem CID 140851064) has the molecular formula C19H29O7P2-3 and a molecular weight of 431.38 g/mol. Its IUPAC name is [[(2Z)-2-[(4aR,4bR,8aR)-4b,8,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-ylidene]ethoxy]-oxidophosphoryl] phosphate.
| Compound Name | [[(2Z)-2-[(4aR,4bR,8aR)-4b,8,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-ylidene]ethoxy]-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 140851064 |
| Molecular Formula | C19H29O7P2-3 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [[(2Z)-2-[(4aR,4bR,8aR)-4b,8,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-ylidene]ethoxy]-oxidophosphoryl] phosphate |
| SMILES | CC1(C)CCC[C@@]2(C)[C@@H]3CC/C(=C/COP(=O)([O-])OP(=O)([O-])[O-])C=C3CC[C@H]12 |
| InChI | InChI=1S/C19H32O7P2/c1-18(2)10-4-11-19(3)16-7-5-14(13-15(16)6-8-17(18)19)9-12-25-28(23,24)26-27(20,21)22/h9,13,16-17H,4-8,10-12H2,1-3H3,(H,23,24)(H2,20,21,22)/p-3/b14-9-/t16-,17-,19+/m1/s1 |
| InChIKey | HLZICWRPRJATHD-FTVYDZAYSA-K |
| XLogP | 3.21 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|