C19H30O — CID 135049419
(4bS,10aR)-4b,8,8,10a-tetramethyl-1-methylidene-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 135049419) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (4bS,10aR)-4b,8,8,10a-tetramethyl-1-methylidene-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | (4bS,10aR)-4b,8,8,10a-tetramethyl-1-methylidene-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 135049419 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (4bS,10aR)-4b,8,8,10a-tetramethyl-1-methylidene-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | C=C1C(=O)CCC2[C@@]3(C)CCCC(C)(C)C3CC[C@@]12C |
| InChI | InChI=1S/C19H30O/c1-13-14(20)7-8-16-18(13,4)12-9-15-17(2,3)10-6-11-19(15,16)5/h15-16H,1,6-12H2,2-5H3/t15?,16?,18-,19-/m0/s1 |
| InChIKey | NPXRIDJZQUFLCP-VHZYLWGESA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|