C28H42 — CID 162907534
(4aR,6aS,6aR,6bR,14aS,14bR)-4,4,6a,6a,10,14b-hexamethyl-1,2,3,4a,5,6,6b,7,8,13,14,14a-dodecahydropicene (PubChem CID 162907534) has the molecular formula C28H42 and a molecular weight of 378.64 g/mol. Its IUPAC name is (4aR,6aS,6aR,6bR,14aS,14bR)-4,4,6a,6a,10,14b-hexamethyl-1,2,3,4a,5,6,6b,7,8,13,14,14a-dodecahydropicene.
| Compound Name | (4aR,6aS,6aR,6bR,14aS,14bR)-4,4,6a,6a,10,14b-hexamethyl-1,2,3,4a,5,6,6b,7,8,13,14,14a-dodecahydropicene |
|---|---|
| PubChem CID | 162907534 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | (4aR,6aS,6aR,6bR,14aS,14bR)-4,4,6a,6a,10,14b-hexamethyl-1,2,3,4a,5,6,6b,7,8,13,14,14a-dodecahydropicene |
| SMILES | Cc1ccc2c(c1)CC[C@@H]1[C@@]3(C)CC[C@@H]4C(C)(C)CCC[C@@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H42/c1-19-8-10-21-20(18-19)9-11-23-26(21,4)16-13-24-27(5)15-7-14-25(2,3)22(27)12-17-28(23,24)6/h8,10,18,22-24H,7,9,11-17H2,1-6H3/t22-,23+,24+,26+,27-,28-/m1/s1 |
| InChIKey | WLZSATLXKYSIHL-ADXZKVTDSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |