C18H26O — CID 135067648
(2S,4aS,10aR)-1,1,4a,7-tetramethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 135067648) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (2S,4aS,10aR)-1,1,4a,7-tetramethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2S,4aS,10aR)-1,1,4a,7-tetramethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 135067648 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (2S,4aS,10aR)-1,1,4a,7-tetramethyl-2,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | Cc1ccc2c(c1)CC[C@H]1C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C18H26O/c1-12-5-7-14-13(11-12)6-8-15-17(2,3)16(19)9-10-18(14,15)4/h5,7,11,15-16,19H,6,8-10H2,1-4H3/t15-,16-,18+/m0/s1 |
| InChIKey | YAKXDJHTDDCDEH-XYJFISCASA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |