C17H30 — CID 142271959
ethane;1,3,3,6-tetramethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene (PubChem CID 142271959) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is ethane;1,3,3,6-tetramethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene.
| Compound Name | ethane;1,3,3,6-tetramethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene |
|---|---|
| PubChem CID | 142271959 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | ethane;1,3,3,6-tetramethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene |
| SMILES | C=C(C)/C=C/C1=C(C)C(C)CCC1(C)C.CC |
| InChI | InChI=1S/C15H24.C2H6/c1-11(2)7-8-14-13(4)12(3)9-10-15(14,5)6;1-2/h7-8,12H,1,9-10H2,2-6H3;1-2H3/b8-7+; |
| InChIKey | HTWPBLBQSUMDGG-USRGLUTNSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|