C17H23NO — CID 121374047
(2E,4E,6E)-7-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-5-methylhepta-2,4,6-trienenitrile (PubChem CID 121374047) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (2E,4E,6E)-7-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-5-methylhepta-2,4,6-trienenitrile.
| Compound Name | (2E,4E,6E)-7-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-5-methylhepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 121374047 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (2E,4E,6E)-7-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-5-methylhepta-2,4,6-trienenitrile |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C#N)C(C)(C)CCC1O |
| InChI | InChI=1S/C17H23NO/c1-13(7-5-6-12-18)8-9-15-14(2)16(19)10-11-17(15,3)4/h5-9,16,19H,10-11H2,1-4H3/b6-5+,9-8+,13-7+ |
| InChIKey | HOQYPBFQKWTDDO-AGOCETDLSA-N |
| XLogP | 4.07 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|