C22H34O3 — CID 57326421
ethyl (3S,4E,6Z,8E)-9-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-4,6,8-trienoate (PubChem CID 57326421) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is ethyl (3S,4E,6Z,8E)-9-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-4,6,8-trienoate.
| Compound Name | ethyl (3S,4E,6Z,8E)-9-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-4,6,8-trienoate |
|---|---|
| PubChem CID | 57326421 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | ethyl (3S,4E,6Z,8E)-9-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-4,6,8-trienoate |
| SMILES | CCOC(=O)C[C@H](C)/C=C/C=C(C)\C=C\C1=C(C)C(O)CCC1(C)C |
| InChI | InChI=1S/C22H34O3/c1-7-25-21(24)15-17(3)10-8-9-16(2)11-12-19-18(4)20(23)13-14-22(19,5)6/h8-12,17,20,23H,7,13-15H2,1-6H3/b10-8+,12-11+,16-9-/t17-,20?/m1/s1 |
| InChIKey | RZODBTMERRWEHX-LRGVPLLMSA-N |
| XLogP | 5.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|