C16H26O2 — CID 135133622
ethyl (3R,4E,6Z,8E)-3,7,10-trimethylundeca-4,6,8-trienoate (PubChem CID 135133622) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is ethyl (3R,4E,6Z,8E)-3,7,10-trimethylundeca-4,6,8-trienoate.
| Compound Name | ethyl (3R,4E,6Z,8E)-3,7,10-trimethylundeca-4,6,8-trienoate |
|---|---|
| PubChem CID | 135133622 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | ethyl (3R,4E,6Z,8E)-3,7,10-trimethylundeca-4,6,8-trienoate |
| SMILES | CCOC(=O)C[C@@H](C)/C=C/C=C(C)\C=C\C(C)C |
| InChI | InChI=1S/C16H26O2/c1-6-18-16(17)12-15(5)9-7-8-14(4)11-10-13(2)3/h7-11,13,15H,6,12H2,1-5H3/b9-7+,11-10+,14-8-/t15-/m0/s1 |
| InChIKey | KGLKOBXMRSVSDB-OVSUXXSVSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|